Paclitaxel ceribate

This classification denotes a taxane compound and taxane-site binding agent C51H57NO18, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier B3C86E80A0, chemically known as 7.beta.-((2rs)-2,3-dihydroxypropoxycarbonyloxy)-1-hydroxy-9-oxo-5.beta.,20-epoxytax-11-ene-2.alpha.,4,10.beta.,13.alpha.-tetrayl 4,10-diacetate 2-benzoate 13-((2r,3s)-3-benzamido-2-hydroxy-3-phenylpropanoate), but more generally known as paclitaxel ceribate, which bears US NIH Compound Identifier 16760673. As of Q4 2014, PACLITAXEL CERIBATE remains US FDA's Preferred Term for this commodity. Paclitaxel ceribate bears US NLM identifiers UMLS ID C3273125 and NCI Concept Code C96934. Most nations, for tariff and trade purposes, schedule paclitaxel ceribate under HS 29329950 and SITC 51569. SMILES: CC1=C2[C@H](C(=O)[C@@]3([C@H](C[C@@H]4[C@]([C@H]3[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@@H](C5CCCCC5)NC(=O)C6CCCCC6)O)O)OC(=O)C7CCCCC7)(CO4)OC(=O)C)OC(=O)OCC(CO)O)C)OC(=O)C.