Nimustine hydrochloride

This classification denotes a nitrosourea compound with the molecular formula C9H13ClN6O2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier DFR965WKBU, chemically known as urea, n-((4-amino-2-methyl-5-pyrimidinyl)methyl)-n-(2-chloroethyl)-n-nitroso- but more generally known as nimustine hydrochloride, which bears US NIH Compound Identifier 39214. European Medicines Agency schedules Nimustine hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB03435MIG. Most nations, for tariff and trade purposes, schedule nimustine hydrochloride under HS 29335995 and SITC 51576. As of Q4 2014, NIMUSTINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Nimustine hydrochloride bears US NLM identifiers UMLS ID C0771987 and NCI Concept Code C95325. SMILES: CC1NCC(C(N1)N)CNC(=O)N(CCCL)N=O.CL.