Meobentine

This classification denotes an antiarrhythmic agent with the molecular formula C11H17N3O, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier (SRS UNII) T91E239Z1V, chemically known as 1-[(4-methoxyphenyl)methyl]-2,3-dimethylguanidine but more generally known as meobentine, which bears US NIH Compound Identifier 42765. European Medicines Agency schedules meobentine its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB08743MIG. Most nations, for tariff and trade purposes, schedule meobentine under HS 29252900 and SITC 51482. As of Q4 2014, MEOBENTINE remains US FDA's Preferred Term for this commodity. SMILES: CNC(=NC)NCC1=CC=C(C=C1)OC.