Pentastarch

This classification denotes a carbohydrate, polysaccharide, and glucan, and a derivative of starch used as a plasma substitute in the treatment of hemorrhage, also sometimes called hetastarch, a preparation that typically bears the molecular formula C29H52O21 and which is chemically known as 5-[6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxymethyl]-3,4-dihydroxy-5-[4-hydroxy-3-(2-hydroxyethoxy)-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)-2-methyloxane-3,4-diol, but generally known as pentastarch, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier MOQ3RNM0S, which bears US NIH Compound Identifier 24846132. European Medicines Agency schedules Pentastarch and Hetastarch in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Indices SUB20665 and SUB14097MIG. As of Q4 2014, PENTASTARCH remains the US FDA Preferred Term for this commodity. SMILES: CC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)COC3C(C(C(C(O3)CO)OC)O)O)OC4C(C(C(C(O4)CO)OC)O)OCCO)O)O)O)O.