Bismuth subsalicylate

This classification denotes a cytoprotective agent and antidiarrheal agent with the molecular formula C7H4O3.Bi.HO, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 62TEY51RR1, chemically known as salicylic acid, bismuth(3+) salt (3:1) but generally known as bismuth salicylate, which bears US NIH Compound Identifier 197976. European Medicines Agency schedules Bismuth subsalicylate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13093MIG. As of Q4 2014, BISMUTH SUBSALICYLATE remains the US FDA Preferred Term for this commodity. Bismuth subsalicylate bears US NLM identifiers UMLS ID C0053792 and NCI Concept Code C1020. SMILES: C1=CC=C2C(=C1)C(=O)O[Bi]O2.O.