Cynarine

This classification denotes a cholagogue or choleretic agent with the molecular formula C25H24O12, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 85D81U9JAV, chemically known as 1,5-dicaffeoylqunic acid but generally known as cynarine, which bears US NIH Compound Identifier 5281769. European Medicines Agency schedules Cynarine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06870MIG. The term CYNARINE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 27, No. 10 1973, List 13). Most nations schedule cynarine under HS 29182980 and SITC 51394. As of Q4 2014, CYNARINE remains the US FDA Preferred Term for this commodity. Cynarine bears US NLM identifiers UMLS ID C0056848 and NCI Concept Code C81041. SMILES: C1C(C(C(CC1(C(=O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O)O)O.