Menotropin

This classification denotes extracts of urine from menopausal women that contain high concentrations of pituitary gonadotropins, follicle stimulating hormone and luteinizing hormone, and which are used to treat infertility, preparations that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 5Y9QQM372Q, and generally arise in the molecular formula C42H65N11O12S2, chemically known as 1-[19-amino-7-(2-amino-2-oxoethyl)-13-butan-2-yl-10-(1-hydroxyethyl)-16-[(4-hydroxyphenyl)methyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carbonyl]-N-[1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide, but generally known as menotropins, and sometimes also called urofollitropin, and which bear US NIH Compound Identifier 62819. The term UROFOLLITROPIN, the synonym for this commodity, is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 1, No. 4, 1987, List 27.) SMILES: CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)NC(C(=O)N1)CC2=CC=C(C=C2)O)N)C(=O)N3CCCC3C(=O)NC(CC(C)C)C(=O)NCC(=O)N)CC(=O)N)C(C)O.