Desmopressin acetate anhydrous

This classification denotes an antidiurectic hormone analogue with the molecular formula C46H64N14O12S2.C2H4O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 1K12647SFC, chemically known as 1-(3-mercaptopropionic acid)-8-d-arginine-vasopressin monoacetate (salt), but more generally known as desmopressin acetate anhydrous, which bears US NIH Compound Identifier 64758. European Medicines Agency schedules desmopressin acetate anhydrous or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB07001MIG. Most nations, for tariff purposes, schedule desmopressin acetate anhydrous under HS 29371900. SMILES: CC(=O)O.C1CCC(CC1)C[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CSSCCC(=O)N[C@H](C(=O)N2)CC3CCC(CC3)O)C(=O)N4CCC[C@H]4C(=O)N[C@H](CCCNC(=N)N)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N.