Phenformin hydrochloride

This classification denotes an anti-diabetic agent with the molecular formula C10H15N5.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 91XC93EU03, chemically known as imidodicarbonimidic diamide, n- (2-phenylethyl)-, monohydrochloride but more generally known as phenformin hydrochloride, which bears US NIH Compound Identifier 8249. European Medicines Agency schedules Phenformin hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB03743MIG. Most nations, for tariff and trade purposes, schedule phenformin hydrochloride under HS 29252900 and SITC 51482. As of Q4 2014, PHENFORMIN HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Phenformin hydrochloride bears US NLM identifiers UMLS ID C0770237 and NCI Concept Code C81696. SMILES: C1CCC(CC1)CCNC(=N)NC(=N)N.CL.