Pioglitazone hydrochloride

This classification denotes a hypoglycemic agent with the molecular formula C19H20N2O3S.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier JQT35NPK6C, chemically known as 2,4-thiazolidinedione, 5-((4-(2-(5-ethyl-2-pyridinyl)ethoxy)phenyl)methyl)- but more generally known as pioglitazone hydrochloride, which bears US NIH Compound Identifier 4829. European Medicines Agency schedules Pioglitazone hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB03834MIG. Most nations, for tariff and trade purposes, schedule pioglitazone hydrochloride under HS 29341000 and SITC 51579. As of Q4 2014, PIOGLITAZONE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Pioglitazone hydrochloride bears US NLM identifiers UMLS ID C0872972 and NCI Concept Code C29367. SMILES: CCC1CCC(NC1)CCOC2CCC(CC2)CC3C(=O)NC(=O)S3.CL.