Resiquimod

This classification denotes a biological response modifier with the molecular formula C17H22N4O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier V3DMU7PVXF, chemically known as 1h-imidazo(4,5-c)quinoline-1-ethanol, 4-amino-2-(ethoxymethyl)-alpha,alpha-dimethyl- but generally known as resiquimod, which bears US NIH Compound Identifier 159603. The term RESIQUIMOD is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 14, No. 3, 2000, List 44). Most nations schedule resiquimod under HS 29339990 and SITC 51577. As of Q4 2014, RESIQUIMOD remains the US FDA Preferred Term for this commodity. Resiquimod bears US NLM identifiers UMLS ID C0389573 and NCI Concept Code C63958. SMILES: CCOCC1=NC2=C(N1CC(C)(C)O)C3=CC=CC=C3N=C2N.