Tacrolimus anhydrous

This classification denotes a mtor inhibitor and immunosuppressant with the molecular formula C44H69NO12, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Y5L2157C4J, chemically known as tacrolimus, anhydrous, but more generally known as tacrolimus anhydrous, which bears US NIH Compound Identifier 6436007. European Medicines Agency schedules tacrolimus anhydrous or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10797MIG. Most nations, for tariff purposes, schedule tacrolimus anhydrous under HS 29349990. Tacrolimus anhydrous bears US NLM identifiers UMLS ID C0771204 and NCI Concept Code C76066. SMILES: C[C@@H]1C[C@@H]([C@@H]2[C@H](C[C@H]([C@@](O2)(C(=O)C(=O)N3CCCC[C@H]3C(=O)O[C@@H]([C@@H]([C@H](CC(=O)[C@@H](/C=C(/C1)\C)CC=C)O)C)/C(=C/[C@@H]4CC[C@H]([C@@H](C4)OC)O)/C)O)C)OC)OC.