Azathioprine

This classification denotes a purine antagonist and immunosuppressant with the molecular formula C9H6N7O2S.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier (SRS UNII) AM94R510MS, chemically known as 6-1-methyl,4-nitro,5-imidazolyl mercaptopurine but more generally known as azathioprine sodium, which bears US NIH Compound Identifier 2265. European Medicines Agency schedules Azathioprine sodium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00641MIG. Most nations, for tariff and trade purposes, schedule azathioprine under HS 29335995 and SITC 51576. As of Q4 2014, AZATHIOPRINE remains US FDA's Preferred Term for this commodity. Azathioprine bears US NLM identifiers UMLS ID C0004482 and NCI Concept Code C290. SMILES: CN1C=NC(=C1SC2=NC=NC3=C2NC=N3)[N+](=O)[O-].