Fiduxosin

This classification denotes an alpha-adrenergic blocking agent with the molecular formula C30H29N5O4S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier W9O92HYT6I, chemically known as 8-phenyl-3-(4-((3ar,9br)-1,3a,4,9b-tetrahydro-9-methoxy(1)benzopyrano(3,4-c)pyrrol-2(3h)-yl)butyl)pyrazino(2,3:4,5)thieno(3,2-d)pyrimidine-2,4(1h,3h)-dione. but generally known as fiduxosin, which bears US NIH Compound Identifier 172307. The term FIDUXOSIN is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 14, No. 3, 2000, List 44). Most nations schedule fiduxosin under HS 29349990 and SITC 51579. As of Q4 2014, FIDUXOSIN remains the US FDA Preferred Term for this commodity. Fiduxosin bears US NLM identifiers UMLS ID C1120505 and NCI Concept Code C65682. SMILES: COC1=CC=CC2=C1C3CN(CC3CO2)CCCCN4C(=O)C5=C(C6=NC(=CN=C6S5)C7=CC=CC=C7)NC4=O.