Hexoprenaline sulfate

This classification denotes a beta-adrenergic agonist with the molecular formula C22H32N2O6.H2O4S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier U851S9102C, chemically known as 4,4-(hexane-1,6-diylbis(iminio(1-hydroxyethylene)))dipyrocatecholsulphate but more generally known as hexoprenaline sulfate, which bears US NIH Compound Identifier 36094. European Medicines Agency schedules Hexoprenaline sulfate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02516MIG. Most nations, for tariff and trade purposes, schedule hexoprenaline sulfate under HS 29225000 and SITC 51467. As of Q4 2014, HEXOPRENALINE SULFATE remains US FDA's Preferred Term for this commodity. Hexoprenaline sulfate bears US NLM identifiers UMLS ID C0813200 and NCI Concept Code C83756. SMILES: C1CC(C(CC1C(CNCCCCCCNCC(C2CCC(C(C2)O)O)O)O)O)O.OS(=O)(=O)O.