Ethyl chloride

This classification denotes an analgesic agent, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 46U771ERWK. European Medicines Agency schedules Ethyl chloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13740MIG. Ethyl chloride generally arises in the molecular formula C2H5CL. The term ETHYL CHLORIDE is a U.S. Pharmacopeial Convention designation. Most nations schedule ethyl chloride under HS 29031190 and SITC 51136. As of Q4 2014, ETHYL CHLORIDE remains the US FDA Preferred Term for this commodity. Ethyl chloride bears US NLM identifiers UMLS ID C0015058 and NCI Concept Code C75067. SMILES: CCC(=C)C(=O)C1=C(C(=C(C=C1)OCC(=O)[O-])CL)CL.[NA+].