Phenacaine hydrochloride anhydrous

This classification denotes an anesthetic agent with the molecular formula C18H22N2O2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 2B61HM98KO, chemically known as ethanimidamide, n,n'-bis(4-ethoxyphenol)-, monohydrochloride, but more generally known as phenacaine hydrochloride anhydrous, which bears US NIH Compound Identifier 12113. European Medicines Agency schedules phenacaine hydrochloride anhydrous or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09743MIG. Most nations, for tariff purposes, schedule phenacaine hydrochloride anhydrous under HS 29252900. Phenacaine hydrochloride anhydrous bears US NLM identifiers UMLS ID C2827603 and NCI Concept Code C85245. SMILES: CCOC1CCC(CC1)N/C(=N/C2CCC(CC2)OCC)/C.CL.