Etomidate sulfate

This classification denotes an anesthetic agent with the molecular formula C14H16N2O2.H2O4S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Y26131IQZI, chemically known as 1h-imidazole-5-carboxylic acid, 1-(1-phenylethyl)-, ethyl ester, (r)- sulfate (1:1) but more generally known as etomidate sulfate, which bears US NIH Compound Identifier 3084993. European Medicines Agency schedules Etomidate sulfate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02047MIG. Most nations, for tariff and trade purposes, schedule etomidate sulfate under HS 29332990 and SITC 51573. As of Q4 2014, ETOMIDATE SULFATE remains US FDA's Preferred Term for this commodity. SMILES: CCOC(=O)C1CNCN1[C@H](C)C2CCCCC2.OS(=O)(=O)O.