Fospropofol

This classification denotes an anesthetic agent with the molecular formula C13H19O5P.2Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier LZ257RZP7K, chemically known as methanol, (2,6-bis(1-methylethyl)phenoxy)-, dihydrogen phosphate but generally known as fospropofol, which bears US NIH Compound Identifier 3038497. European Medicines Agency schedules Fospropofol in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB32986. Most nations schedule fospropofol under HS 29199000 and SITC 51631. As of Q4 2014, FOSPROPOFOL remains the US FDA Preferred Term for this commodity. Fospropofol bears US NLM identifiers UMLS ID C2370726 and NCI Concept Code C76954. SMILES: CC(C)C1=C(C(=CC=C1)C(C)C)OCOP(=O)(O)O.