Cocaine muriate

This classification denotes a cns stimulant with the molecular formula C17H21NO4.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier XH8T8T6WZH, chemically known as methyl (1r,2r,3s,5s)-3- (benzoyloxy)-8-methyl-8-azabicyclo(3.2.1) octane-2-carboxylate, hydrochloride, but more generally known as cocaine muriate, which bears US NIH Compound Identifier 2826. European Medicines Agency schedules cocaine muriate or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13416MIG. Most nations, for tariff purposes, schedule cocaine muriate under HS 29399110. SMILES: CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)OC(=O)C3CCCCC3)C(=O)OC.CL.