Bacampicillin hydrochloride

This classification denotes a penicillin antibiotic with the molecular formula C21H27N3O7S.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier PM034U953T, chemically known as 4-thia-1-azabicyclo(3.2.0)heptane-2-carboxylic acid, 6-((aminophenylacetyl)amino)-3,3-dimethyl-7-oxo-, 1-((ethoxycarbonyl)oxy)ethyl ester, monohydrochloride, (2s-(2alpha,5alpha,6beta(s*)))- but more generally known as bacampicillin hydrochloride, which bears US NIH Compound Identifier 71429. European Medicines Agency schedules Bacampicillin hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB00649MIG. Most nations, for tariff and trade purposes, schedule bacampicillin hydrochloride under HS 29411090 and SITC 54131. As of Q4 2014, BACAMPICILLIN HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Bacampicillin hydrochloride bears US NLM identifiers UMLS ID C1122338 and NCI Concept Code C65246. SMILES: CCOC(=O)OC(C)OC(=O)[C@H]1C(S[C@H]2N1C(=O)[C@H]2NC(=O)[C@@H](C3CCCCC3)N)(C)C.CL.