Thiamphenicol glycinate hydrochloride

This classification denotes a protein synthesis inhibitor and antibiotic with the molecular formula C14H18Cl2N2O6S.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 88VGC22BWE, chemically known as glycine, (2r,3r)-2-((2,2-dichloroacetyl)amino)-3-hydroxy-3-(4-(methylsulfonyl)phenyl)propyl ester, hydrochloride (1:1), but more generally known as thiamphenicol glycinate hydrochloride, which bears US NIH Compound Identifier 197006. European Medicines Agency schedules thiamphenicol glycinate hydrochloride or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10970MIG. Most nations, for tariff purposes, schedule thiamphenicol glycinate hydrochloride under HS 29414000. SMILES: CS(=O)(=O)C1CCC(CC1)[C@H]([C@@H](COC(=O)CN)NC(=O)C(CL)CL)O.CL.