Meropenem anhydrous

This classification denotes a beta-lactam antibiotic with the molecular formula C17H25N3O5S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier YOP6PX0BAO, chemically known as (4r,5s,6s)-3-(((3s,5s)-5-(dimethylcarbamoyl)-3-pyrrolidinyl)thio)-6-((1r)-1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid, but more generally known as meropenem anhydrous, which bears US NIH Compound Identifier 64778. European Medicines Agency schedules meropenem anhydrous or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB08778MIG. Most nations, for tariff purposes, schedule meropenem anhydrous under HS 29419000. Meropenem anhydrous bears US NLM identifiers UMLS ID C1881787 and NCI Concept Code C61833. SMILES: C[C@@H]1[C@@H]2[C@H](C(=O)N2C(=C1S[C@H]3C[C@H](NC3)C(=O)N(C)C)C(=O)O)[C@@H](C)O.