Penoctonium

This classification denotes a topical anti-infective agent with the molecular formula C26H50NO2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 5VT390WD2G, chemically known as 2-(2,2-dicyclopentylacetyl)oxyethyl-diethyl-octylazanium but generally known as penoctonium, which bears US NIH Compound Identifier 71690. European Medicines Agency schedules Penoctonium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB09672MIG. The term PENOCTONIUM is an International Non-Proprietary Name. As of Q4 2014, PENOCTONIUM remains the US FDA Preferred Term for this commodity. Penoctonium bears US NLM identifiers UMLS ID C0604630 and NCI Concept Code C87269. SMILES: CCCCCCCC[N+](CC)(CC)CCOC(=O)C(C1CCCC1)C2CCCC2.