Lasalocid sodium

This classification denotes an antibiotic with the molecular formula C34H53O8.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier W2S5C71Y3G, chemically known as 2,3-cresotic acid, 6-(7-(5-ethyl-5-(5-ethyltetrahydro-5-hydroxy-6-methyl-2h-pyran-2-yl)tetrahydro-3-methyl-2-furyl)-4-hydroxy-3,5-dimethyl-6-oxononyl)-, monosodium salt. (-)- but more generally known as lasalocid sodium, which bears US NIH Compound Identifier 33265. Most nations schedule lasalocid sodium under HS 29419000. As of Q4 2014, LASALOCID SODIUM remains the US FDA Preferred Term for this commodity. Lasalocid sodium bears US NLM identifiers UMLS ID C0878439 and NCI Concept Code C79535. SMILES: CC[C@H]([C@@H]1[C@H](C[C@@](O1)(CC)[C@H]2CC[C@@]([C@@H](O2)C)(CC)O)C)C(=O)[C@@H](C)[C@H]([C@H](C)CCC3CCC(C(C3C(=O)[O-])O)C)O.[NA+].