Fosfomycin tromethamine

This classification denotes a urinary anti-infective agent with the molecular formula C4H11NO3.C3H7O4P, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 7FXW6U30GY, chemically known as phosphonic acid, (3-methyloxiranyl)-, (2r-cis)-, compd. with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) but more generally known as fosfomycin trometamol, which bears US NIH Compound Identifier 54331. European Medicines Agency schedules Fosfomycin trometamol in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02263MIG. Most nations schedule fosfomycin tromethamine under HS 29419000. As of Q4 2014, FOSFOMYCIN TROMETHAMINE remains the US FDA Preferred Term for this commodity. Fosfomycin tromethamine bears US NLM identifiers UMLS ID C0543454 and NCI Concept Code C47541. SMILES: C[C@H]1[C@H](O1)P(=O)(O)O.C(C(CO)(CO)N)O.