Nefazodone hydrochloride

This classification denotes a triazole, analgesic, and second-generation antidepressive agent with the molecular formula C25H32ClN5O2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 27X63J94GR, chemically known as 3h-1,2,4-triazol-3-one, 2,4-dihydro-2-3-(4-(3-chlorophenyl)-1-piperazinyl)propyl)-5-ethyl-4-(2-phenoxyethyl)- but more generally known as nefazodone hydrochloride, which bears US NIH Compound Identifier 4449. European Medicines Agency schedules Nefazodone hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB03399MIG. Most nations, for tariff and trade purposes, schedule nefazodone hydrochloride under HS 29335995 and SITC 51576. As of Q4 2014, NEFAZODONE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Nefazodone hydrochloride bears US NLM identifiers UMLS ID C0771310 and NCI Concept Code C29283. SMILES: CCC1NN(C(=O)N1CCOC2CCCCC2)CCCN3CCN(CC3)C4CCCC(C4)CL.CL.