Bipenamol

This classification denotes a serotonin agonist with the molecular formula C14H15NOS, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 49DCB7156W, chemically known as [2-[2-(aminomethyl)phenyl]sulfanylphenyl]methanol but generally known as cericlamine, which bears US NIH Compound Identifier 43961. European Medicines Agency schedules Bipenamol in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05842MIG. The term BIPENAMOL is an International Non-Proprietary Name (see WHO INN reference publication, Volume 39, No. 5, 1985, List 25.) Most nations schedule bipenamol under HS 29309085 and SITC 51549. As of Q4 2014, BIPENAMOL remains the US FDA Preferred Term for this commodity. Bipenamol bears US NLM identifiers UMLS ID C2698511 and NCI Concept Code C79854. SMILES: C1=CC=C(C(=C1)CN)SC2=CC=CC=C2CO.