Napactadine hydrochloride

This classification denotes a histamine-1 receptor antagonist with the molecular formula C14H16N2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 9FB1F1BV0M, chemically known as 2-naphthaleneethanimidamide, n,n-dimethyl-, monohydrochloride but more generally known as napactadine hydrochloride, which bears US NIH Compound Identifier 42152. Most nations, for tariff and trade purposes, schedule napactadine hydrochloride under HS 29252900 and SITC 51482. As of Q4 2014, NAPACTADINE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Napactadine hydrochloride bears US NLM identifiers UMLS ID C2827273 and NCI Concept Code C83984. SMILES: CN/C(=N\C)/CC1CCC2CCCCC2C1.CL.