Itopride hydrochloride

This classification denotes an antidepressant agent with the molecular formula C20H26N2O4.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 2H9NV66W0I, chemically known as n-((4-(2-(dimethylamino)ethoxy)phenyl)methyl)-3,4-dimethoxybenzamide monohydrochloride but more generally known as itopride hydrochloride, which bears US NIH Compound Identifier 129791. European Medicines Agency schedules Itopride hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB16440MIG. Most nations, for tariff and trade purposes, schedule itopride hydrochloride under HS 29242995 and SITC 51479. As of Q4 2014, ITOPRIDE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Itopride hydrochloride bears US NLM identifiers UMLS ID C0082935 and NCI Concept Code C99563. SMILES: CN(C)CCOC1CCC(CC1)CNC(=O)C2CCC(C(C2)OC)OC.CL.