Phenelzine sulfate

This classification denotes a monoamine oxidase inhibitor with the molecular formula C8H12N2.H2O4S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 2681D7P965, chemically known as hydrazine, phenethyl-, sulfate (1:1) but more generally known as phenelzine sulfate, which bears US NIH Compound Identifier 61100. European Medicines Agency schedules Phenelzine sulfate in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB03740MIG. Most nations, for tariff and trade purposes, schedule phenelzine sulfate under HS 29280090 and SITC 51486. As of Q4 2014, PHENELZINE SULFATE remains US FDA's Preferred Term for this commodity. Phenelzine sulfate bears US NLM identifiers UMLS ID C0701388 and NCI Concept Code C47668. SMILES: C1CCC(CC1)CCNN.OS(=O)(=O)O.