Gepirone hydrochloride

This classification denotes a serotonin agonist and anxiolytic with the molecular formula C19H29N5O2.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 80C9L8EP6V, chemically known as 3,3-dimethyl-1-(4-(4-(2-pyrimidinyl)-1-piperazinyl)butyl)glutarimide monohydrochloride but more generally known as gepirone hydrochloride, which bears US NIH Compound Identifier 55190. Most nations, for tariff and trade purposes, schedule gepirone hydrochloride under HS 29335995 and SITC 51576. As of Q4 2014, GEPIRONE HYDROCHLORIDE remains US FDA's Preferred Term for this commodity. Gepirone hydrochloride bears US NLM identifiers UMLS ID C2348751 and NCI Concept Code C72795. SMILES: CC1(CC(=O)N(C(=O)C1)CCCCN2CCN(CC2)C3NCCCN3)C.CL.