Clodazon hydrochloride anhydrous

This classification denotes an antidepressant agent C18H20ClN3O.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier N0FW29BP3C, chemically known as 2h-benzimidazol-2-one,5-chloro-1-(3-(dimethylamino)propyl)-1,3-dihydro-3-phenyl-, monohydrochloride, but more generally known as clodazon hydrochloride anhydrous, which bears US NIH Compound Identifier 56841979. Most nations, for tariff and trade purposes, schedule clodazon hydrochloride anhydrous under HS 29339990 and SITC 51577. As of Q4 2014, CLODAZON HYDROCHLORIDE ANHYDROUS remains US FDA's Preferred Term for this commodity. Clodazon hydrochloride anhydrous bears US NLM identifiers UMLS ID C2699361 and NCI Concept Code C78675. SMILES: CN(C)CCCN1C2CCC(CC2N(C1=O)C3CCCCC3)CL.CL.