Piroctone olamine or octopirox or piroctone ethanolamine

This classification denotes an agent affecting integumentary system with the molecular formula C14H23NO2.C2H7NO, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier A4V5C6R9FB, chemically known as 2(1h)-pyridinone, 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-, compound with 2-aminoethanol (1:1) but generally known as piroctone olamine, which bears US NIH Compound Identifier 50258. European Medicines Agency schedules Piroctone olamine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB23293. SMILES: CC1=CC(=O)N(C(=C1)CC(C)CC(C)(C)C)O.C(CO)N.