Candicidin d

This classification denotes an antibiotic with the molecular formula C59H84N2O18, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 5190Y348H9, chemically known as candicidin d, (32e)-, but more generally known as candicidin d, which bears US NIH Compound Identifier 441142. European Medicines Agency schedules candicidin d or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB01021MIG. Most nations, for tariff purposes, schedule candicidin d under HS 29419000. SMILES: C[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@@H](C[C@@H]([C@@H]([C@H](CC(=O)C[C@H](C[C@H](C[C@H](CC(=O)CCCC(=O)CC(=O)O[C@@H]1[C@@H](C)C[C@H](C)[C@H](CC(=O)C2CCC(CC2)N)O)O)O)O)O)C(=O)O)O)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)C)O)N)O.