Fosfluconazole

This classification denotes an antifungal agent with the molecular formula C13H13F2N6O4P, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 3JIJ299EWH, chemically known as 2,4-difluoro-alpha,alpha-bis(1h-1,2,4-triazol-1-ylmethyl)benzyl alcohol, dihydrogen phosphate (ester) but generally known as fosfluconazole, which bears US NIH Compound Identifier 214356. European Medicines Agency schedules Fosfluconazole in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB20639. The term FOSFLUCONAZOLE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 15 No. 1, 2001, List 45). Most nations schedule fosfluconazole under HS 29339990 and SITC 51577. As of Q4 2014, FOSFLUCONAZOLE remains the US FDA Preferred Term for this commodity. Fosfluconazole bears US NLM identifiers UMLS ID C1452382 and NCI Concept Code C81503. SMILES: P(=O)(OC(CN1NCNC1)(CN1NCNC1)C1C(F)CC(F)CC1)(O)O.