Bensuldazic acid

This classification denotes an antifungal agent with the molecular formula C12H14N2O2S2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier R8L0T98P0J, chemically known as 5-benzyldihydro-6-thioxo-2h-1,3,5-thiadiazine-3(4h)-acetic acid but generally known as bensuldazic acid, which bears US NIH Compound Identifier 71462. European Medicines Agency schedules Bensuldazic acid in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB05732MIG. The term BENSULDAZIC ACID is an International Non-Proprietary Name. Most nations schedule bensuldazic acid under HS 29349990 and SITC 51579. As of Q4 2014, BENSULDAZIC ACID remains the US FDA Preferred Term for this commodity. Bensuldazic acid bears US NLM identifiers UMLS ID C2346996 and NCI Concept Code C72090. SMILES: C1N(CSC(=S)N1CC2=CC=CC=C2)CC(=O)O.