Ravuconazole

This classification denotes an antifungal agent with the molecular formula C22H17F2N5OS, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 95YH599JWV, chemically known as bms-207,147 but generally known as ravuconazole, which bears US NIH Compound Identifier 467825. The term RAVUCONAZOLE is an International Non-Proprietary Name. Most nations schedule ravuconazole under HS 29341000 and SITC 51579. As of Q4 2014, RAVUCONAZOLE remains the US FDA Preferred Term for this commodity. Ravuconazole bears US NLM identifiers UMLS ID C0535186 and NCI Concept Code C38688. SMILES: CC(C1=NC(=CS1)C2=CC=C(C=C2)C#N)C(CN3C=NC=N3)(C4=C(C=C(C=C4)F)F)O.