Lodoxamide ethyl

This classification denotes a mast cell stabilizer with the molecular formula C15H14ClN3O6, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier TQY1B8145B, chemically known as acetic acid, 2,2'-((2-chloro-5-cyano-1,3-phenylene)diimino)-, bis 2-oxo-, diethyl ester, but more generally known as lodoxamide ethyl, which bears US NIH Compound Identifier 40915. European Medicines Agency schedules lodoxamide ethyl or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB08553MIG. Most nations, for tariff purposes, schedule lodoxamide ethyl under HS 29269095. SMILES: CCOC(=O)C(=O)NC1CC(CC(C1CL)NC(=O)C(=O)OCC)C#N.