Chlorothen

This classification denotes a histamine-1 receptor antagonist with the molecular formula C14H18ClN3S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Y6068K376I, chemically known as 2-((5-chloro-2-thenyl)(2-(dimethylamino)ethyl)amino)pyridine but generally known as chlorothen, which bears US NIH Compound Identifier 8993. European Medicines Agency schedules chloropyrilene in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB06195MIG. The term chloropyrilene is a U.S. FDA designation. As of Q4 2014, CHLOROTHEN remains the US FDA Preferred Term for this commodity. Chlorothen bears US NLM identifiers UMLS ID C0164505 and NCI Concept Code C83621. SMILES: CN(C)CCN(CC1=CC=C(S1)Cl)C2=CC=CC=N2.