Pyrrobutamine

This classification denotes a histamine-1 receptor antagonist with the molecular formula C20H22ClN, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier VE6KP18S8X, chemically known as pyrrolidine, 1-(4-(4-chlorophenyl)-3-phenyl-2-butenyl)- but generally known as pyrrobutamine, which bears US NIH Compound Identifier 5284614. European Medicines Agency schedules Pyrrobutamine in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB15066MIG. World Health Organization schedules pyrrobutamine in its Anatomical Therapeutic Chemical (ATC) Classification. As of Q4 2014, PYRROBUTAMINE remains the US FDA Preferred Term for this commodity. Pyrrobutamine bears US NLM identifiers UMLS ID C0163091 and NCI Concept Code C81146. SMILES: CLC1CCC(C/C(=C\CN2CCCC2)C2CCCCC2)CC1.