Talastine hydrochloride

This classification denotes a histamine-1 receptor antagonist with the molecular formula C19H21N3O.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier SBH6TU2VU4, chemically known as 2-(2-(dimethylamino)ethyl)-4-(phenylmethyl)-1(2h)-phthalazinone hydrochloride, but more generally known as talastine hydrochloride, which bears US NIH Compound Identifier 167517. European Medicines Agency schedules talastine hydrochloride or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB10801MIG. Most nations, for tariff purposes, schedule talastine hydrochloride under HS 29339990. Talastine hydrochloride bears US NLM identifiers UMLS ID C0121937 and NCI Concept Code C95238. SMILES: CN(C)CCN1C(=O)C2CCCCC2C(N1)CC3CCCCC3.CL.