Thiazinam or thiazinamium

This classification denotes a histamine-1 receptor antagonist with the molecular formula C18H23N2S, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 666W2P28N2, chemically known as 10h-phenothiazine-10-ethanaminium, n,n,n,alpha-tetramethyl-, methyl sulfate but generally known as thiazinamium, which bears US NIH Compound Identifier 6015. European Medicines Agency schedules Thiazinamium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB15532MIG. As of Q4 2014, THIAZINAMIUM remains the US FDA Preferred Term for this commodity. Thiazinamium bears US NLM identifiers UMLS ID C0039857 and NCI Concept Code C84203. SMILES: S1C2C(N(CC([N](C)(C)C)C)C3C1CCCC3)CCCC2.S(=O)(=O)(OC)O.