Fexofenadine hydrochloride

This classification denotes a histamine-1 receptor antagonist with the molecular formula C32H39NO4.ClH, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 2S068B75ZU, chemically known as 3,5-pyridinedicarboxylic acid, 4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-, ethyl methyl ester but generally known as fexofenadine hydrochloride, which bears US NIH Compound Identifier 3333. European Medicines Agency schedules Fexofenadine hydrochloride in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB13884MIG. Most nations schedule fexofenadine hydrochloride under HS 29333999 and SITC 51574. As of Q4 2014, FEXOFENADINE HYDROCHLORIDE remains the US FDA Preferred Term for this commodity. Fexofenadine hydrochloride bears US NLM identifiers UMLS ID C0771752 and NCI Concept Code C29050. SMILES: CC(C)(C1=CC=C(C=C1)C(CCCN2CCC(CC2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O)C(=O)O.Cl.