Flutropium

This classification denotes a mast cell stabilizer with the molecular formula C24H29FNO3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier TA73FX29II, chemically known as [(1R,5R)-8-(2-fluoroethyl)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl]2-hydroxy-2,2-diphenylacetate but generally known as flutropium, which bears US NIH Compound Identifier 71962. European Medicines Agency schedules Flutropium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02242MIG. The term FLUTROPIUM is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 38, No. 6, 1984, List 24). As of Q4 2014, FLUTROPIUM remains the US FDA Preferred Term for this commodity. Flutropium bears US NLM identifiers UMLS ID C0873172 and NCI Concept Code C87639. SMILES: C[N+]1(C2CCC1CC(C2)OC(=O)C(C3=CC=CC=C3)(C4=CC=CC=C4)O)CCF.