Fluvastatin sodium

This classification denotes a hmg-coa reductase inhibitor with the molecular formula C24H25FNO4.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier PYF7O1FV7F, chemically known as 6-heptenoic acid, 7-(3-(4-fluorophenyl)-1-(1-methylethyl)-1h-indol-2-yl)-3,5-dihydroxy-, monosodium salt, (r*,s*-(e))-(+-)- but more generally known as fluvastatin sodium, which bears US NIH Compound Identifier 5281101. European Medicines Agency schedules Fluvastatin sodium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB02243MIG. Most nations, for tariff and trade purposes, schedule fluvastatin sodium under HS 29339990 and SITC 51577. As of Q4 2014, FLUVASTATIN SODIUM remains US FDA's Preferred Term for this commodity. Fluvastatin sodium bears US NLM identifiers UMLS ID C0246203 and NCI Concept Code C29062. SMILES: CC(C)N1C2CCCCC2C(C1/C=C/[C@@H](C[C@@H](CC(=O)[O-])O)O)C3CCC(CC3)F.[NA+].