Dirlotapide

This classification denotes an anorexiant with the molecular formula C40H33F3N4O3, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 578H0RMP25, chemically known as 1h-indole-2-carboxamide, 1-methyl-n-((1s)-2-(methyl(phenylmethyl)amino)-2-oxo-1-phenylethyl)-5-(((4-(trifluoromethyl)(1,1-biphenyl)-2-yl)carbonyl)amino)- but generally known as dirlotapide, which bears US NIH Compound Identifier 6433125. The term DIRLOTAPIDE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 19, No. 1, 2005, List 53). Most nations schedule dirlotapide under HS 29339990 and SITC 51577. As of Q4 2014, DIRLOTAPIDE remains the US FDA Preferred Term for this commodity. Dirlotapide bears US NLM identifiers UMLS ID C1958588 and NCI Concept Code C77329. SMILES: CN1C2=C(C=C(C=C2)NC(=O)C3=CC=CC=C3C4=CC=C(C=C4)C(F)(F)F)C=C1C(=O)NC(C5=CC=CC=C5)C(=O)N(C)CC6=CC=CC=C6.