Implitapide

This classification denotes an anti-lipidemic agent with the molecular formula C35H37N3O2, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier Q70OH404HR, chemically known as (alphas)-alpha-(alpha-(2,4-dimethyl-9h-pyrido(2,3-b)indol-9-yl)-p-tolyl)-n-((alphar)-alpha-(hydroxymethyl)benzyl)cyclopentaneacetamide. but generally known as implitapide, which bears US NIH Compound Identifier 5745206. The term IMPLITAPIDE is an International Non-Proprietary Name or INN (see WHO INN reference publication, Volume 14, No. 3, 2000, List 44). Most nations schedule implitapide under HS 29339990 and SITC 51577. As of Q4 2014, IMPLITAPIDE remains the US FDA Preferred Term for this commodity. Implitapide bears US NLM identifiers UMLS ID C1100413 and NCI Concept Code C65901. SMILES: CC1=CC(=NC2=C1C3=CC=CC=C3N2CC4=CC(=CC=C4)C(C5CCCC5)C(=O)NC(CO)C6=CC=CC=C6)C.