Pravastatin sodium

This classification denotes an antilipemic fungal metabolite, anticholesteremic agent, and hydroxymethylglutaryl-coa reductase inhibitor with the molecular formula C23H35O7.Na, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 3M8608UQ61, chemically known as 1,2,6,7,8,8a-hexahydro-beta,delta,6-trihydroxy-2-methyl-8-(2-methyl-1-oxobutoxy)-, (1s-(1alpha(betas*,deltas*),2alpha,6alpha,8beta(r*),8aalpha))-1-naphthaleneheptanoic acid but more generally known as pravastatin sodium, which bears US NIH Compound Identifier 54687. European Medicines Agency schedules Pravastatin sodium in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB04011MIG. Most nations, for tariff and trade purposes, schedule pravastatin sodium under HS 29181985 and SITC 51392. As of Q4 2014, PRAVASTATIN SODIUM remains US FDA's Preferred Term for this commodity. Pravastatin sodium bears US NLM identifiers UMLS ID C0700763 and NCI Concept Code C29375. SMILES: CC[C@H](C)C(=O)O[C@H]1C[C@@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@H](C[C@H](CC(=O)[O-])O)O)O.[NA+].