Levocarnitine acetyl

This classification denotes a nutritional supplement with the molecular formula C9H17NO4, a preparation that US FDA regulates as an active ingredient or moiety under Unique Ingredient Identifier 6DH1W9VH8Q, chemically known as l-(3-carboxy-2-hydroxypropyl)trimethylammonium hydroxide inner salt acetate, but more generally known as levocarnitine acetyl, which bears US NIH Compound Identifier 18230. European Medicines Agency schedules levocarnitine acetyl or its base in its eXtended EudraVigilance Medicinal Product Dictionary or XEVMPD under Index SUB08466MIG. Most nations, for tariff purposes, schedule levocarnitine acetyl under HS 29239000. SMILES: CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C.